C13H6F10O4 — CID 91710793
[2-methyl-3-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710793) has the molecular formula C13H6F10O4 and a molecular weight of 416.17 g/mol. Its IUPAC name is [2-methyl-3-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [2-methyl-3-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710793 |
| Molecular Formula | C13H6F10O4 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | [2-methyl-3-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | Cc1c(OC(=O)C(F)(F)C(F)(F)F)cccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H6F10O4/c1-5-6(26-8(24)10(14,15)12(18,19)20)3-2-4-7(5)27-9(25)11(16,17)13(21,22)23/h2-4H,1H3 |
| InChIKey | NPZQBNXXIOBJDN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|