C15H3F15O6 — CID 91710602
[2,3-bis(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710602) has the molecular formula C15H3F15O6 and a molecular weight of 564.15 g/mol. Its IUPAC name is [2,3-bis(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [2,3-bis(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710602 |
| Molecular Formula | C15H3F15O6 |
| Molecular Weight | 564.15 g/mol |
| Exact Mass | 563.97 |
| IUPAC Name | [2,3-bis(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(Oc1cccc(OC(=O)C(F)(F)C(F)(F)F)c1OC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H3F15O6/c16-10(17,13(22,23)24)7(31)34-4-2-1-3-5(35-8(32)11(18,19)14(25,26)27)6(4)36-9(33)12(20,21)15(28,29)30/h1-3H |
| InChIKey | LTEIEOOUEFMQRH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.15 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|