C12H5F5O4 — CID 91739886
(2-oxochromen-4-yl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91739886) has the molecular formula C12H5F5O4 and a molecular weight of 308.16 g/mol. Its IUPAC name is (2-oxochromen-4-yl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (2-oxochromen-4-yl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91739886 |
| Molecular Formula | C12H5F5O4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | (2-oxochromen-4-yl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(Oc1cc(=O)oc2ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F5O4/c13-11(14,12(15,16)17)10(19)21-8-5-9(18)20-7-4-2-1-3-6(7)8/h1-5H |
| InChIKey | UPQMSHVFIYAWIP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|