C15H17NO5 — CID 169095175
N-hydroxy-6-(2-oxochromen-4-yl)oxyhexanamide (PubChem CID 169095175) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-hydroxy-6-(2-oxochromen-4-yl)oxyhexanamide.
| Compound Name | N-hydroxy-6-(2-oxochromen-4-yl)oxyhexanamide |
|---|---|
| PubChem CID | 169095175 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-hydroxy-6-(2-oxochromen-4-yl)oxyhexanamide |
| SMILES | O=C(CCCCCOc1cc(=O)oc2ccccc12)NO |
| InChI | InChI=1S/C15H17NO5/c17-14(16-19)8-2-1-5-9-20-13-10-15(18)21-12-7-4-3-6-11(12)13/h3-4,6-7,10,19H,1-2,5,8-9H2,(H,16,17) |
| InChIKey | JQGMXFFAXNKXRB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|