About 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride
4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride (PubChem CID 158605000) has the molecular formula C23H24ClNO6
and a molecular weight of 445.90 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride |
| PubChem CID | 158605000 |
| Molecular Formula | C23H24ClNO6 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride |
| SMILES | CN(C)CCCOc1cc(=O)oc2ccccc12.Cl.O=c1cc(O)c2ccccc2o1 |
| InChI | InChI=1S/C14H17NO3.C9H6O3.ClH/c1-15(2)8-5-9-17-13-10-14(16)18-12-7-4-3-6-11(12)13;10-7-5-9(11)12-8-4-2-1-3-6(7)8;/h3-4,6-7,10H,5,8-9H2,1-2H3;1-5,10H;1H |
| InChIKey | DNPAXZKABHMRTH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride?
The IUPAC name of 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride (CID 158605000) is 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride.
What is the SMILES notation for 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride?
The canonical SMILES for 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride is CN(C)CCCOc1cc(=O)oc2ccccc12.Cl.O=c1cc(O)c2ccccc2o1.
What is the InChIKey of 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride?
The InChIKey is DNPAXZKABHMRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3.C9H6O3.ClH/c1-15(2)8-5-9-17-13-10-14(16)18-12-7-4-3-6-11(12)13;10-7-5-9(11)12-8-4-2-1-3-6(7)8;/h3-4,6-7,10H,5,8-9H2,1-2H3;1-5,10H;1H.
What are the key properties of 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride?
4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride has a molecular weight of 445.90 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(dimethylamino)propoxy]chromen-2-one;4-hydroxychromen-2-one;hydrochloride is sourced from PubChem (CID 158605000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).