About 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal
4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal (PubChem CID 164525573) has the molecular formula C18H24O6
and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal.
Molecular Properties
| Compound Name | 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal |
| PubChem CID | 164525573 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal |
| SMILES | CC(C)C=O.COCCOCCOc1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C14H16O5.C4H8O/c1-16-6-7-17-8-9-18-13-10-14(15)19-12-5-3-2-4-11(12)13;1-4(2)3-5/h2-5,10H,6-9H2,1H3;3-4H,1-2H3 |
| InChIKey | AZMUQYUJPWWSFP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal?
The IUPAC name of 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal (CID 164525573) is 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal.
What is the SMILES notation for 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal?
The canonical SMILES for 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal is CC(C)C=O.COCCOCCOc1cc(=O)oc2ccccc12.
What is the InChIKey of 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal?
The InChIKey is AZMUQYUJPWWSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O5.C4H8O/c1-16-6-7-17-8-9-18-13-10-14(15)19-12-5-3-2-4-11(12)13;1-4(2)3-5/h2-5,10H,6-9H2,1H3;3-4H,1-2H3.
What are the key properties of 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal?
4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal has a molecular weight of 336.38 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-methoxyethoxy)ethoxy]chromen-2-one;2-methylpropanal is sourced from PubChem (CID 164525573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).