C20H15NNa2O9 — CID 102227768
disodium;4-[2-[2-(2-oxochromen-4-yl)oxyethoxy]ethoxy]pyridine-2,6-dicarboxylate (PubChem CID 102227768) has the molecular formula C20H15NNa2O9 and a molecular weight of 459.32 g/mol. Its IUPAC name is disodium;4-[2-[2-(2-oxochromen-4-yl)oxyethoxy]ethoxy]pyridine-2,6-dicarboxylate.
| Compound Name | disodium;4-[2-[2-(2-oxochromen-4-yl)oxyethoxy]ethoxy]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102227768 |
| Molecular Formula | C20H15NNa2O9 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | disodium;4-[2-[2-(2-oxochromen-4-yl)oxyethoxy]ethoxy]pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cc(OCCOCCOc2cc(=O)oc3ccccc23)cc(C(=O)[O-])n1.[Na+].[Na+] |
| InChI | InChI=1S/C20H17NO9.2Na/c22-18-11-17(13-3-1-2-4-16(13)30-18)29-8-6-27-5-7-28-12-9-14(19(23)24)21-15(10-12)20(25)26;;/h1-4,9-11H,5-8H2,(H,23,24)(H,25,26);;/q;2*+1/p-2 |
| InChIKey | KTWFINULPPHZNU-UHFFFAOYSA-L |
| XLogP | -6.60 |
| TPSA | 151.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|