C23H23NO11 — CID 102227777
4-[2-[2-[2-(7-methoxy-2-oxochromen-4-yl)oxyethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylic acid (PubChem CID 102227777) has the molecular formula C23H23NO11 and a molecular weight of 489.43 g/mol. Its IUPAC name is 4-[2-[2-[2-(7-methoxy-2-oxochromen-4-yl)oxyethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[2-[2-(7-methoxy-2-oxochromen-4-yl)oxyethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 102227777 |
| Molecular Formula | C23H23NO11 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 4-[2-[2-[2-(7-methoxy-2-oxochromen-4-yl)oxyethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylic acid |
| SMILES | COc1ccc2c(OCCOCCOCCOc3cc(C(=O)O)nc(C(=O)O)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H23NO11/c1-30-14-2-3-16-19(13-21(25)35-20(16)12-14)34-9-7-32-5-4-31-6-8-33-15-10-17(22(26)27)24-18(11-15)23(28)29/h2-3,10-13H,4-9H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | KTOCFZLWJJMJIG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 163.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|