C20H24I2O6 — CID 164525124
6-(7-methoxy-2-oxochromen-4-yl)oxyhexyl 2,3-diiodo-2-methylpropanoate (PubChem CID 164525124) has the molecular formula C20H24I2O6 and a molecular weight of 614.21 g/mol. Its IUPAC name is 6-(7-methoxy-2-oxochromen-4-yl)oxyhexyl 2,3-diiodo-2-methylpropanoate.
| Compound Name | 6-(7-methoxy-2-oxochromen-4-yl)oxyhexyl 2,3-diiodo-2-methylpropanoate |
|---|---|
| PubChem CID | 164525124 |
| Molecular Formula | C20H24I2O6 |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 613.97 |
| IUPAC Name | 6-(7-methoxy-2-oxochromen-4-yl)oxyhexyl 2,3-diiodo-2-methylpropanoate |
| SMILES | COc1ccc2c(OCCCCCCOC(=O)C(C)(I)CI)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H24I2O6/c1-20(22,13-21)19(24)27-10-6-4-3-5-9-26-16-12-18(23)28-17-11-14(25-2)7-8-15(16)17/h7-8,11-12H,3-6,9-10,13H2,1-2H3 |
| InChIKey | BVQWSCSTVXHSSL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|