C17H22O5Si — CID 57363666
2-(7-methoxy-2-oxochromen-4-yl)-4-trimethylsilylbutanoic acid (PubChem CID 57363666) has the molecular formula C17H22O5Si and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(7-methoxy-2-oxochromen-4-yl)-4-trimethylsilylbutanoic acid.
| Compound Name | 2-(7-methoxy-2-oxochromen-4-yl)-4-trimethylsilylbutanoic acid |
|---|---|
| PubChem CID | 57363666 |
| Molecular Formula | C17H22O5Si |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(7-methoxy-2-oxochromen-4-yl)-4-trimethylsilylbutanoic acid |
| SMILES | COc1ccc2c(C(CC[Si](C)(C)C)C(=O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H22O5Si/c1-21-11-5-6-12-14(10-16(18)22-15(12)9-11)13(17(19)20)7-8-23(2,3)4/h5-6,9-10,13H,7-8H2,1-4H3,(H,19,20) |
| InChIKey | DOYWADWJNLMULF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|