C18H24N2O7 — CID 161200338
(2S)-2,6-diaminohexanoic acid;2-(7-methoxy-2-oxochromen-4-yl)acetic acid (PubChem CID 161200338) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;2-(7-methoxy-2-oxochromen-4-yl)acetic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;2-(7-methoxy-2-oxochromen-4-yl)acetic acid |
|---|---|
| PubChem CID | 161200338 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;2-(7-methoxy-2-oxochromen-4-yl)acetic acid |
| SMILES | COc1ccc2c(CC(=O)O)cc(=O)oc2c1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H10O5.C6H14N2O2/c1-16-8-2-3-9-7(4-11(13)14)5-12(15)17-10(9)6-8;7-4-2-1-3-5(8)6(9)10/h2-3,5-6H,4H2,1H3,(H,13,14);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | UUWUORFGKAYZFJ-ZSCHJXSPSA-N |
| XLogP | 0.96 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|