About (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate
(7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate (PubChem CID 7229879) has the molecular formula C21H20O6
and a molecular weight of 368.39 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate.
Molecular Properties
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate |
| PubChem CID | 7229879 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)OCc1cc(=O)oc2cc(OC)ccc12 |
| InChI | InChI=1S/C21H20O6/c1-3-18(26-15-7-5-4-6-8-15)21(23)25-13-14-11-20(22)27-19-12-16(24-2)9-10-17(14)19/h4-12,18H,3,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | SXQCNEZIZGSCMO-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate?
The IUPAC name of (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate (CID 7229879) is (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate.
What is the SMILES notation for (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate?
The canonical SMILES for (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate is CC[C@H](Oc1ccccc1)C(=O)OCc1cc(=O)oc2cc(OC)ccc12.
What is the InChIKey of (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate?
The InChIKey is SXQCNEZIZGSCMO-SFHVURJKSA-N. The full InChI is InChI=1S/C21H20O6/c1-3-18(26-15-7-5-4-6-8-15)21(23)25-13-14-11-20(22)27-19-12-16(24-2)9-10-17(14)19/h4-12,18H,3,13H2,1-2H3/t18-/m0/s1.
What are the key properties of (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate?
(7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate has a molecular weight of 368.39 g/mol, XLogP of 3.70, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-2-oxochromen-4-yl)methyl (2S)-2-phenoxybutanoate is sourced from PubChem (CID 7229879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).