C25H23NO7 — CID 3933815
(7-methoxy-2-oxochromen-4-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 3933815) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 3933815 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | COc1ccc2c(COC(=O)C(CC(C)C)N3C(=O)c4ccccc4C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H23NO7/c1-14(2)10-20(26-23(28)18-6-4-5-7-19(18)24(26)29)25(30)32-13-15-11-22(27)33-21-12-16(31-3)8-9-17(15)21/h4-9,11-12,14,20H,10,13H2,1-3H3 |
| InChIKey | WQLMTVGPAXDFDQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|