C28H21NO8 — CID 3911944
(7-methoxy-2-oxochromen-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate (PubChem CID 3911944) has the molecular formula C28H21NO8 and a molecular weight of 499.48 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 3911944 |
| Molecular Formula | C28H21NO8 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
| SMILES | COc1ccc2c(COC(=O)c3cc(CN4C(=O)c5ccccc5C4=O)ccc3OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C28H21NO8/c1-34-18-8-9-19-17(12-25(30)37-24(19)13-18)15-36-28(33)22-11-16(7-10-23(22)35-2)14-29-26(31)20-5-3-4-6-21(20)27(29)32/h3-13H,14-15H2,1-2H3 |
| InChIKey | BJKVGNYJNNOQNO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|