C28H22N2O6 — CID 16589210
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate (PubChem CID 16589210) has the molecular formula C28H22N2O6 and a molecular weight of 482.49 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 16589210 |
| Molecular Formula | C28H22N2O6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C28H22N2O6/c1-17-23(29-25(36-17)19-8-4-3-5-9-19)16-35-28(33)22-14-18(12-13-24(22)34-2)15-30-26(31)20-10-6-7-11-21(20)27(30)32/h3-14H,15-16H2,1-2H3 |
| InChIKey | CBYCSWXBFGGQMK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|