C21H32O5 — CID 151741693
2-[2-(1-carboxy-4-methylpentyl)-4-methoxyphenyl]-5-methylhexanoic acid (PubChem CID 151741693) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[2-(1-carboxy-4-methylpentyl)-4-methoxyphenyl]-5-methylhexanoic acid.
| Compound Name | 2-[2-(1-carboxy-4-methylpentyl)-4-methoxyphenyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 151741693 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[2-(1-carboxy-4-methylpentyl)-4-methoxyphenyl]-5-methylhexanoic acid |
| SMILES | COc1ccc(C(CCC(C)C)C(=O)O)c(C(CCC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C21H32O5/c1-13(2)6-9-17(20(22)23)16-11-8-15(26-5)12-19(16)18(21(24)25)10-7-14(3)4/h8,11-14,17-18H,6-7,9-10H2,1-5H3,(H,22,23)(H,24,25) |
| InChIKey | RMRDHTOPKKHQPK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |