C22H34O5 — CID 150500133
2-[2-(1-carboxy-3-methylbutyl)-4-(2-methylpropoxy)phenyl]-4-methylpentanoic acid (PubChem CID 150500133) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[2-(1-carboxy-3-methylbutyl)-4-(2-methylpropoxy)phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[2-(1-carboxy-3-methylbutyl)-4-(2-methylpropoxy)phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 150500133 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[2-(1-carboxy-3-methylbutyl)-4-(2-methylpropoxy)phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)COc1ccc(C(CC(C)C)C(=O)O)c(C(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C22H34O5/c1-13(2)9-19(21(23)24)17-8-7-16(27-12-15(5)6)11-18(17)20(22(25)26)10-14(3)4/h7-8,11,13-15,19-20H,9-10,12H2,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | HXQGELGEXLNSQO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |