C28H46O5 — CID 150751939
2-[2-(1-carboxy-5-methylhexyl)-4-hexoxyphenyl]-6-methylheptanoic acid (PubChem CID 150751939) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is 2-[2-(1-carboxy-5-methylhexyl)-4-hexoxyphenyl]-6-methylheptanoic acid.
| Compound Name | 2-[2-(1-carboxy-5-methylhexyl)-4-hexoxyphenyl]-6-methylheptanoic acid |
|---|---|
| PubChem CID | 150751939 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 2-[2-(1-carboxy-5-methylhexyl)-4-hexoxyphenyl]-6-methylheptanoic acid |
| SMILES | CCCCCCOc1ccc(C(CCCC(C)C)C(=O)O)c(C(CCCC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C28H46O5/c1-6-7-8-9-18-33-22-16-17-23(24(27(29)30)14-10-12-20(2)3)26(19-22)25(28(31)32)15-11-13-21(4)5/h16-17,19-21,24-25H,6-15,18H2,1-5H3,(H,29,30)(H,31,32) |
| InChIKey | JWAYHXFTFFHNNP-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|