C29H48O4 — CID 151851049
2-[2-(1-carboxy-5-methylhexyl)-3-heptylphenyl]-6-methylheptanoic acid (PubChem CID 151851049) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 2-[2-(1-carboxy-5-methylhexyl)-3-heptylphenyl]-6-methylheptanoic acid.
| Compound Name | 2-[2-(1-carboxy-5-methylhexyl)-3-heptylphenyl]-6-methylheptanoic acid |
|---|---|
| PubChem CID | 151851049 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 2-[2-(1-carboxy-5-methylhexyl)-3-heptylphenyl]-6-methylheptanoic acid |
| SMILES | CCCCCCCc1cccc(C(CCCC(C)C)C(=O)O)c1C(CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C29H48O4/c1-6-7-8-9-10-16-23-17-13-18-24(25(28(30)31)19-11-14-21(2)3)27(23)26(29(32)33)20-12-15-22(4)5/h13,17-18,21-22,25-26H,6-12,14-16,19-20H2,1-5H3,(H,30,31)(H,32,33) |
| InChIKey | SIRSFTWGKLXLIF-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|