2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid

C16H24O3 — CID 112509429

IUPAC2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid
SMILESCCOc1cc(C)c(C(CC(C)C)C(=O)O)cc1C
InChIInChI=1S/C16H24O3/c1-6-19-15-9-11(4)13(8-12(15)5)14(16(17)18)7-10(2)3/h8-10,14H,6-7H2,1-5H3,(H,17,18)
InChIKeyAYIBJNLWIXFWEF-UHFFFAOYSA-N
MW264.36 g/mol
LogP3.92
Rot. Bonds6

About 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid

2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid (PubChem CID 112509429) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid
PubChem CID112509429
Molecular FormulaC16H24O3
Molecular Weight264.36 g/mol
Exact Mass264.17
IUPAC Name2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid
SMILESCCOc1cc(C)c(C(CC(C)C)C(=O)O)cc1C
InChIInChI=1S/C16H24O3/c1-6-19-15-9-11(4)13(8-12(15)5)14(16(17)18)7-10(2)3/h8-10,14H,6-7H2,1-5H3,(H,17,18)
InChIKeyAYIBJNLWIXFWEF-UHFFFAOYSA-N
XLogP3.92
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.36
LogP ≤ 53.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid?
The IUPAC name of 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid (CID 112509429) is 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid.
What is the SMILES notation for 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid?
The canonical SMILES for 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid is CCOc1cc(C)c(C(CC(C)C)C(=O)O)cc1C.
What is the InChIKey of 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid?
The InChIKey is AYIBJNLWIXFWEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-6-19-15-9-11(4)13(8-12(15)5)14(16(17)18)7-10(2)3/h8-10,14H,6-7H2,1-5H3,(H,17,18).
What are the key properties of 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid?
2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid has a molecular weight of 264.36 g/mol, XLogP of 3.92, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxy-2,5-dimethylphenyl)-4-methylpentanoic acid is sourced from PubChem (CID 112509429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).