C22H20N2O13-4 — CID 132601045
4-[2-[2-[2-[2-[(2,6-dicarboxylato-4-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylate (PubChem CID 132601045) has the molecular formula C22H20N2O13-4 and a molecular weight of 520.40 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[(2,6-dicarboxylato-4-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylate.
| Compound Name | 4-[2-[2-[2-[2-[(2,6-dicarboxylato-4-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 132601045 |
| Molecular Formula | C22H20N2O13-4 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 4-[2-[2-[2-[2-[(2,6-dicarboxylato-4-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cc(OCCOCCOCCOCCOc2cc(C(=O)[O-])nc(C(=O)[O-])c2)cc(C(=O)[O-])n1 |
| InChI | InChI=1S/C22H24N2O13/c25-19(26)15-9-13(10-16(23-15)20(27)28)36-7-5-34-3-1-33-2-4-35-6-8-37-14-11-17(21(29)30)24-18(12-14)22(31)32/h9-12H,1-8H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)/p-4 |
| InChIKey | IEMSJGZPOLPEKU-UHFFFAOYSA-J |
| XLogP | -4.56 |
| TPSA | 232.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|