C24H23N3O4 — CID 162371718
5-[(2-benzyl-3-oxo-4H-benzo[f]quinoxalin-6-yl)oxy]-N-hydroxypentanamide (PubChem CID 162371718) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[(2-benzyl-3-oxo-4H-benzo[f]quinoxalin-6-yl)oxy]-N-hydroxypentanamide.
| Compound Name | 5-[(2-benzyl-3-oxo-4H-benzo[f]quinoxalin-6-yl)oxy]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 162371718 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-[(2-benzyl-3-oxo-4H-benzo[f]quinoxalin-6-yl)oxy]-N-hydroxypentanamide |
| SMILES | O=C(CCCCOc1cc2[nH]c(=O)c(Cc3ccccc3)nc2c2ccccc12)NO |
| InChI | InChI=1S/C24H23N3O4/c28-22(27-30)12-6-7-13-31-21-15-19-23(18-11-5-4-10-17(18)21)25-20(24(29)26-19)14-16-8-2-1-3-9-16/h1-5,8-11,15,30H,6-7,12-14H2,(H,26,29)(H,27,28) |
| InChIKey | FECJTCUPSUCMND-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|