About N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide
N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide (PubChem CID 122182514) has the molecular formula C27H32N4O4
and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide.
Molecular Properties
| Compound Name | N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide |
| PubChem CID | 122182514 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide |
| SMILES | O=C(CCCCCCCC(=O)NCc1cc(C(=O)NCc2ccccc2)c2ccccc2n1)NO |
| InChI | InChI=1S/C27H32N4O4/c32-25(15-7-2-1-3-8-16-26(33)31-35)28-19-21-17-23(22-13-9-10-14-24(22)30-21)27(34)29-18-20-11-5-4-6-12-20/h4-6,9-14,17,35H,1-3,7-8,15-16,18-19H2,(H,28,32)(H,29,34)(H,31,33) |
| InChIKey | SWCQOTVPKRNBCS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide?
The IUPAC name of N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide (CID 122182514) is N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide.
What is the SMILES notation for N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide?
The canonical SMILES for N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide is O=C(CCCCCCCC(=O)NCc1cc(C(=O)NCc2ccccc2)c2ccccc2n1)NO.
What is the InChIKey of N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide?
The InChIKey is SWCQOTVPKRNBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N4O4/c32-25(15-7-2-1-3-8-16-26(33)31-35)28-19-21-17-23(22-13-9-10-14-24(22)30-21)27(34)29-18-20-11-5-4-6-12-20/h4-6,9-14,17,35H,1-3,7-8,15-16,18-19H2,(H,28,32)(H,29,34)(H,31,33).
What are the key properties of N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide?
N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide has a molecular weight of 476.58 g/mol, XLogP of 4.02, 13 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(benzylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxynonanediamide is sourced from PubChem (CID 122182514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).