C24H25BrN4O4 — CID 122182524
N-[[6-bromo-4-(phenylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxyheptanediamide (PubChem CID 122182524) has the molecular formula C24H25BrN4O4 and a molecular weight of 513.39 g/mol. Its IUPAC name is N-[[6-bromo-4-(phenylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[6-bromo-4-(phenylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 122182524 |
| Molecular Formula | C24H25BrN4O4 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-[[6-bromo-4-(phenylcarbamoyl)quinolin-2-yl]methyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1cc(C(=O)Nc2ccccc2)c2cc(Br)ccc2n1)NO |
| InChI | InChI=1S/C24H25BrN4O4/c25-16-11-12-21-19(13-16)20(24(32)28-17-7-3-1-4-8-17)14-18(27-21)15-26-22(30)9-5-2-6-10-23(31)29-33/h1,3-4,7-8,11-14,33H,2,5-6,9-10,15H2,(H,26,30)(H,28,32)(H,29,31) |
| InChIKey | AQYSJBOAVQBJAJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|