C19H24N4O4 — CID 122182519
N'-hydroxy-N-[[4-(methylcarbamoyl)quinolin-2-yl]methyl]heptanediamide (PubChem CID 122182519) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-(methylcarbamoyl)quinolin-2-yl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[4-(methylcarbamoyl)quinolin-2-yl]methyl]heptanediamide |
|---|---|
| PubChem CID | 122182519 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N'-hydroxy-N-[[4-(methylcarbamoyl)quinolin-2-yl]methyl]heptanediamide |
| SMILES | CNC(=O)c1cc(CNC(=O)CCCCCC(=O)NO)nc2ccccc12 |
| InChI | InChI=1S/C19H24N4O4/c1-20-19(26)15-11-13(22-16-8-6-5-7-14(15)16)12-21-17(24)9-3-2-4-10-18(25)23-27/h5-8,11,27H,2-4,9-10,12H2,1H3,(H,20,26)(H,21,24)(H,23,25) |
| InChIKey | OYUNUWSNSKJXTP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|