C16H21N3O — CID 63002970
2-amino-N-(4-methylpentyl)quinoline-4-carboxamide (PubChem CID 63002970) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-amino-N-(4-methylpentyl)quinoline-4-carboxamide.
| Compound Name | 2-amino-N-(4-methylpentyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 63002970 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-amino-N-(4-methylpentyl)quinoline-4-carboxamide |
| SMILES | CC(C)CCCNC(=O)c1cc(N)nc2ccccc12 |
| InChI | InChI=1S/C16H21N3O/c1-11(2)6-5-9-18-16(20)13-10-15(17)19-14-8-4-3-7-12(13)14/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | XHLYYLKAAPKXLE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|