C13H15N3O3S — CID 62152474
2-amino-N-(2-methylsulfonylethyl)quinoline-4-carboxamide (PubChem CID 62152474) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-amino-N-(2-methylsulfonylethyl)quinoline-4-carboxamide.
| Compound Name | 2-amino-N-(2-methylsulfonylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 62152474 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-amino-N-(2-methylsulfonylethyl)quinoline-4-carboxamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1cc(N)nc2ccccc12 |
| InChI | InChI=1S/C13H15N3O3S/c1-20(18,19)7-6-15-13(17)10-8-12(14)16-11-5-3-2-4-9(10)11/h2-5,8H,6-7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | XDSWOZACWBSOGN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |