About N-hydroxy-6-phenylhexanamide;thiohydroxylamine
N-hydroxy-6-phenylhexanamide;thiohydroxylamine (PubChem CID 142086803) has the molecular formula C12H20N2O2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is N-hydroxy-6-phenylhexanamide;thiohydroxylamine.
Molecular Properties
| Compound Name | N-hydroxy-6-phenylhexanamide;thiohydroxylamine |
| PubChem CID | 142086803 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-hydroxy-6-phenylhexanamide;thiohydroxylamine |
| SMILES | NS.O=C(CCCCCc1ccccc1)NO |
| InChI | InChI=1S/C12H17NO2.H3NS/c14-12(13-15)10-6-2-5-9-11-7-3-1-4-8-11;1-2/h1,3-4,7-8,15H,2,5-6,9-10H2,(H,13,14);2H,1H2 |
| InChIKey | JKRWLBOOVKLJPV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-6-phenylhexanamide;thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-6-phenylhexanamide;thiohydroxylamine?
The IUPAC name of N-hydroxy-6-phenylhexanamide;thiohydroxylamine (CID 142086803) is N-hydroxy-6-phenylhexanamide;thiohydroxylamine.
What is the SMILES notation for N-hydroxy-6-phenylhexanamide;thiohydroxylamine?
The canonical SMILES for N-hydroxy-6-phenylhexanamide;thiohydroxylamine is NS.O=C(CCCCCc1ccccc1)NO.
What is the InChIKey of N-hydroxy-6-phenylhexanamide;thiohydroxylamine?
The InChIKey is JKRWLBOOVKLJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.H3NS/c14-12(13-15)10-6-2-5-9-11-7-3-1-4-8-11;1-2/h1,3-4,7-8,15H,2,5-6,9-10H2,(H,13,14);2H,1H2.
What are the key properties of N-hydroxy-6-phenylhexanamide;thiohydroxylamine?
N-hydroxy-6-phenylhexanamide;thiohydroxylamine has a molecular weight of 256.37 g/mol, XLogP of 2.08, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-6-phenylhexanamide;thiohydroxylamine is sourced from PubChem (CID 142086803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).