C16H19NO4 — CID 174900807
benzene;formic acid;N-hydroxy-3-phenylpropanamide (PubChem CID 174900807) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is benzene;formic acid;N-hydroxy-3-phenylpropanamide.
| Compound Name | benzene;formic acid;N-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 174900807 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | benzene;formic acid;N-hydroxy-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NO.O=CO.c1ccccc1 |
| InChI | InChI=1S/C9H11NO2.C6H6.CH2O2/c11-9(10-12)7-6-8-4-2-1-3-5-8;1-2-4-6-5-3-1;2-1-3/h1-5,12H,6-7H2,(H,10,11);1-6H;1H,(H,2,3) |
| InChIKey | MIQMEGVFXNJSHG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|