About N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride
N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride (PubChem CID 159423361) has the molecular formula C20H22ClNO3
and a molecular weight of 359.85 g/mol. Its IUPAC name is N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride.
Molecular Properties
| Compound Name | N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride |
| PubChem CID | 159423361 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride |
| SMILES | O=C(Cl)CCc1ccccc1.O=CCNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H13NO2.C9H9ClO/c13-9-8-12-11(14)7-6-10-4-2-1-3-5-10;10-9(11)7-6-8-4-2-1-3-5-8/h1-5,9H,6-8H2,(H,12,14);1-5H,6-7H2 |
| InChIKey | LQAQFBFGVDMSAR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride?
The IUPAC name of N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride (CID 159423361) is N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride.
What is the SMILES notation for N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride?
The canonical SMILES for N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride is O=C(Cl)CCc1ccccc1.O=CCNC(=O)CCc1ccccc1.
What is the InChIKey of N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride?
The InChIKey is LQAQFBFGVDMSAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.C9H9ClO/c13-9-8-12-11(14)7-6-10-4-2-1-3-5-10;10-9(11)7-6-8-4-2-1-3-5-8/h1-5,9H,6-8H2,(H,12,14);1-5H,6-7H2.
What are the key properties of N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride?
N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride has a molecular weight of 359.85 g/mol, XLogP of 3.32, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxoethyl)-3-phenylpropanamide;3-phenylpropanoyl chloride is sourced from PubChem (CID 159423361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).