About acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide
acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide (PubChem CID 170949279) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide.
Molecular Properties
| Compound Name | acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide |
| PubChem CID | 170949279 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide |
| SMILES | C#C.CC.CC(=O)CNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C12H15NO2.C2H6.C2H2/c1-10(14)9-13-12(15)8-7-11-5-3-2-4-6-11;2*1-2/h2-6H,7-9H2,1H3,(H,13,15);1-2H3;1-2H |
| InChIKey | USSHBFTYCXHHDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide?
The IUPAC name of acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide (CID 170949279) is acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide.
What is the SMILES notation for acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide?
The canonical SMILES for acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide is C#C.CC.CC(=O)CNC(=O)CCc1ccccc1.
What is the InChIKey of acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide?
The InChIKey is USSHBFTYCXHHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2.C2H6.C2H2/c1-10(14)9-13-12(15)8-7-11-5-3-2-4-6-11;2*1-2/h2-6H,7-9H2,1H3,(H,13,15);1-2H3;1-2H.
What are the key properties of acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide?
acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide has a molecular weight of 261.36 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;N-(2-oxopropyl)-3-phenylpropanamide is sourced from PubChem (CID 170949279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).