About methylphosphane;N-(2-oxopropyl)-2-phenylacetamide
methylphosphane;N-(2-oxopropyl)-2-phenylacetamide (PubChem CID 161423403) has the molecular formula C12H18NO2P
and a molecular weight of 239.25 g/mol. Its IUPAC name is methylphosphane;N-(2-oxopropyl)-2-phenylacetamide.
Molecular Properties
| Compound Name | methylphosphane;N-(2-oxopropyl)-2-phenylacetamide |
| PubChem CID | 161423403 |
| Molecular Formula | C12H18NO2P |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | methylphosphane;N-(2-oxopropyl)-2-phenylacetamide |
| SMILES | CC(=O)CNC(=O)Cc1ccccc1.CP |
| InChI | InChI=1S/C11H13NO2.CH5P/c1-9(13)8-12-11(14)7-10-5-3-2-4-6-10;1-2/h2-6H,7-8H2,1H3,(H,12,14);2H2,1H3 |
| InChIKey | VXANQINPKUQIFP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylphosphane;N-(2-oxopropyl)-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylphosphane;N-(2-oxopropyl)-2-phenylacetamide?
The IUPAC name of methylphosphane;N-(2-oxopropyl)-2-phenylacetamide (CID 161423403) is methylphosphane;N-(2-oxopropyl)-2-phenylacetamide.
What is the SMILES notation for methylphosphane;N-(2-oxopropyl)-2-phenylacetamide?
The canonical SMILES for methylphosphane;N-(2-oxopropyl)-2-phenylacetamide is CC(=O)CNC(=O)Cc1ccccc1.CP.
What is the InChIKey of methylphosphane;N-(2-oxopropyl)-2-phenylacetamide?
The InChIKey is VXANQINPKUQIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.CH5P/c1-9(13)8-12-11(14)7-10-5-3-2-4-6-10;1-2/h2-6H,7-8H2,1H3,(H,12,14);2H2,1H3.
What are the key properties of methylphosphane;N-(2-oxopropyl)-2-phenylacetamide?
methylphosphane;N-(2-oxopropyl)-2-phenylacetamide has a molecular weight of 239.25 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylphosphane;N-(2-oxopropyl)-2-phenylacetamide is sourced from PubChem (CID 161423403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).