About (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate
(2-oxochromen-4-yl) 4-propan-2-yloxybenzoate (PubChem CID 888914) has the molecular formula C19H16O5
and a molecular weight of 324.33 g/mol. Its IUPAC name is (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate |
| PubChem CID | 888914 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)Oc2cc(=O)oc3ccccc23)cc1 |
| InChI | InChI=1S/C19H16O5/c1-12(2)22-14-9-7-13(8-10-14)19(21)24-17-11-18(20)23-16-6-4-3-5-15(16)17/h3-12H,1-2H3 |
| InChIKey | LCVIERINSCJDHL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate?
The IUPAC name of (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate (CID 888914) is (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate.
What is the SMILES notation for (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate?
The canonical SMILES for (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate is CC(C)Oc1ccc(C(=O)Oc2cc(=O)oc3ccccc23)cc1.
What is the InChIKey of (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate?
The InChIKey is LCVIERINSCJDHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O5/c1-12(2)22-14-9-7-13(8-10-14)19(21)24-17-11-18(20)23-16-6-4-3-5-15(16)17/h3-12H,1-2H3.
What are the key properties of (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate?
(2-oxochromen-4-yl) 4-propan-2-yloxybenzoate has a molecular weight of 324.33 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-4-yl) 4-propan-2-yloxybenzoate is sourced from PubChem (CID 888914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).