C16H19F5O4Si — CID 91754061
[tert-butyl(dimethyl)silyl] 2-(2,2,3,3,3-pentafluoropropanoyloxy)benzoate (PubChem CID 91754061) has the molecular formula C16H19F5O4Si and a molecular weight of 398.40 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,3-pentafluoropropanoyloxy)benzoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,3-pentafluoropropanoyloxy)benzoate |
|---|---|
| PubChem CID | 91754061 |
| Molecular Formula | C16H19F5O4Si |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(2,2,3,3,3-pentafluoropropanoyloxy)benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1ccccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F5O4Si/c1-14(2,3)26(4,5)25-12(22)10-8-6-7-9-11(10)24-13(23)15(17,18)16(19,20)21/h6-9H,1-5H3 |
| InChIKey | WKIISQGWWGRLNW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|