About [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate
[tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate (PubChem CID 554841) has the molecular formula C13H20O2SSi
and a molecular weight of 268.45 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate |
| PubChem CID | 554841 |
| Molecular Formula | C13H20O2SSi |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1ccccc1S |
| InChI | InChI=1S/C13H20O2SSi/c1-13(2,3)17(4,5)15-12(14)10-8-6-7-9-11(10)16/h6-9,16H,1-5H3 |
| InChIKey | KEEAXGFXJXIFEX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate (CID 554841) is [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate is CC(C)(C)[Si](C)(C)OC(=O)c1ccccc1S.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate?
The InChIKey is KEEAXGFXJXIFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2SSi/c1-13(2,3)17(4,5)15-12(14)10-8-6-7-9-11(10)16/h6-9,16H,1-5H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate?
[tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate has a molecular weight of 268.45 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 2-sulfanylbenzoate is sourced from PubChem (CID 554841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).