C20H34O4Si2 — CID 630744
bis[tert-butyl(dimethyl)silyl] benzene-1,2-dicarboxylate (PubChem CID 630744) has the molecular formula C20H34O4Si2 and a molecular weight of 394.66 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 630744 |
| Molecular Formula | C20H34O4Si2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1ccccc1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si2/c1-19(2,3)25(7,8)23-17(21)15-13-11-12-14-16(15)18(22)24-26(9,10)20(4,5)6/h11-14H,1-10H3 |
| InChIKey | RUGOPMVYGOPNSG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|