C17H19F5O4 — CID 91712878
[2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] octanoate (PubChem CID 91712878) has the molecular formula C17H19F5O4 and a molecular weight of 382.33 g/mol. Its IUPAC name is [2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] octanoate.
| Compound Name | [2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] octanoate |
|---|---|
| PubChem CID | 91712878 |
| Molecular Formula | C17H19F5O4 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccccc1OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H19F5O4/c1-2-3-4-5-6-11-14(23)25-12-9-7-8-10-13(12)26-15(24)16(18,19)17(20,21)22/h7-10H,2-6,11H2,1H3 |
| InChIKey | KGUIYNVSWVMONX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|