C21H22F2O6 — CID 91695235
bis(4-fluoro-2-methoxyphenyl) 2,2-diethylpropanedioate (PubChem CID 91695235) has the molecular formula C21H22F2O6 and a molecular weight of 408.40 g/mol. Its IUPAC name is bis(4-fluoro-2-methoxyphenyl) 2,2-diethylpropanedioate.
| Compound Name | bis(4-fluoro-2-methoxyphenyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91695235 |
| Molecular Formula | C21H22F2O6 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | bis(4-fluoro-2-methoxyphenyl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)Oc1ccc(F)cc1OC)C(=O)Oc1ccc(F)cc1OC |
| InChI | InChI=1S/C21H22F2O6/c1-5-21(6-2,19(24)28-15-9-7-13(22)11-17(15)26-3)20(25)29-16-10-8-14(23)12-18(16)27-4/h7-12H,5-6H2,1-4H3 |
| InChIKey | BQNRXXKLOKNMNX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|