C17H7F15O6 — CID 539201
[2-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]ethyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 539201) has the molecular formula C17H7F15O6 and a molecular weight of 592.21 g/mol. Its IUPAC name is [2-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]ethyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [2-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]ethyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 539201 |
| Molecular Formula | C17H7F15O6 |
| Molecular Weight | 592.21 g/mol |
| Exact Mass | 592.00 |
| IUPAC Name | [2-(2,2,3,3,3-pentafluoropropanoyloxy)-2-[4-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl]ethyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCC(OC(=O)C(F)(F)C(F)(F)F)c1ccc(OC(=O)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H7F15O6/c18-12(19,15(24,25)26)9(33)36-5-8(38-11(35)14(22,23)17(30,31)32)6-1-3-7(4-2-6)37-10(34)13(20,21)16(27,28)29/h1-4,8H,5H2 |
| InChIKey | FQCFIPPAHUKPIS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|