C9H4F10O5 — CID 91710742
[3-oxo-2-(2,2,3,3,3-pentafluoropropanoyloxy)propyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710742) has the molecular formula C9H4F10O5 and a molecular weight of 382.11 g/mol. Its IUPAC name is [3-oxo-2-(2,2,3,3,3-pentafluoropropanoyloxy)propyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [3-oxo-2-(2,2,3,3,3-pentafluoropropanoyloxy)propyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710742 |
| Molecular Formula | C9H4F10O5 |
| Molecular Weight | 382.11 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [3-oxo-2-(2,2,3,3,3-pentafluoropropanoyloxy)propyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=CC(COC(=O)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F10O5/c10-6(11,8(14,15)16)4(21)23-2-3(1-20)24-5(22)7(12,13)9(17,18)19/h1,3H,2H2 |
| InChIKey | GSSCWNQAQDIFLA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|