C5H6F5NO2 — CID 175224554
1-aminoethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 175224554) has the molecular formula C5H6F5NO2 and a molecular weight of 207.10 g/mol. Its IUPAC name is 1-aminoethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 1-aminoethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 175224554 |
| Molecular Formula | C5H6F5NO2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 1-aminoethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CC(N)OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F5NO2/c1-2(11)13-3(12)4(6,7)5(8,9)10/h2H,11H2,1H3 |
| InChIKey | XLKVFJSSCYJLCO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|