C7H11ClF5NO — CID 131719225
(4S)-4-amino-1,1,1,2,2-pentafluoro-5-methylhexan-3-one;hydrochloride (PubChem CID 131719225) has the molecular formula C7H11ClF5NO and a molecular weight of 255.61 g/mol. Its IUPAC name is (4S)-4-amino-1,1,1,2,2-pentafluoro-5-methylhexan-3-one;hydrochloride.
| Compound Name | (4S)-4-amino-1,1,1,2,2-pentafluoro-5-methylhexan-3-one;hydrochloride |
|---|---|
| PubChem CID | 131719225 |
| Molecular Formula | C7H11ClF5NO |
| Molecular Weight | 255.61 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (4S)-4-amino-1,1,1,2,2-pentafluoro-5-methylhexan-3-one;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)C(F)(F)C(F)(F)F.Cl |
| InChI | InChI=1S/C7H10F5NO.ClH/c1-3(2)4(13)5(14)6(8,9)7(10,11)12;/h3-4H,13H2,1-2H3;1H/t4-;/m0./s1 |
| InChIKey | WAVLGLCPGHJLPW-WCCKRBBISA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|