C6H5F5O3 — CID 22105194
propanoyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 22105194) has the molecular formula C6H5F5O3 and a molecular weight of 220.09 g/mol. Its IUPAC name is propanoyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | propanoyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 22105194 |
| Molecular Formula | C6H5F5O3 |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | propanoyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCC(=O)OC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5O3/c1-2-3(12)14-4(13)5(7,8)6(9,10)11/h2H2,1H3 |
| InChIKey | XQQOKSYVXMDDTM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|