C10H13F5O2 — CID 140976002
(1,1,1,2,2-pentafluoro-5-methylhex-3-en-3-yl) propanoate (PubChem CID 140976002) has the molecular formula C10H13F5O2 and a molecular weight of 260.20 g/mol. Its IUPAC name is (1,1,1,2,2-pentafluoro-5-methylhex-3-en-3-yl) propanoate.
| Compound Name | (1,1,1,2,2-pentafluoro-5-methylhex-3-en-3-yl) propanoate |
|---|---|
| PubChem CID | 140976002 |
| Molecular Formula | C10H13F5O2 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (1,1,1,2,2-pentafluoro-5-methylhex-3-en-3-yl) propanoate |
| SMILES | CCC(=O)OC(=CC(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5O2/c1-4-8(16)17-7(5-6(2)3)9(11,12)10(13,14)15/h5-6H,4H2,1-3H3 |
| InChIKey | NKYGQXVYCQYGFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|