C7H9F5OS — CID 100949764
(E)-2-ethoxy-3,3,4,4,4-pentafluoro-1-methylsulfanylbut-1-ene (PubChem CID 100949764) has the molecular formula C7H9F5OS and a molecular weight of 236.20 g/mol. Its IUPAC name is (E)-2-ethoxy-3,3,4,4,4-pentafluoro-1-methylsulfanylbut-1-ene.
| Compound Name | (E)-2-ethoxy-3,3,4,4,4-pentafluoro-1-methylsulfanylbut-1-ene |
|---|---|
| PubChem CID | 100949764 |
| Molecular Formula | C7H9F5OS |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (E)-2-ethoxy-3,3,4,4,4-pentafluoro-1-methylsulfanylbut-1-ene |
| SMILES | CCO/C(=C/SC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F5OS/c1-3-13-5(4-14-2)6(8,9)7(10,11)12/h4H,3H2,1-2H3/b5-4+ |
| InChIKey | YYBGDIVPYLYIPL-SNAWJCMRSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|