C9H14O3S — CID 143260584
(2Z,4E)-2-ethoxy-4-methyl-5-methylsulfanylpenta-2,4-dienoic acid (PubChem CID 143260584) has the molecular formula C9H14O3S and a molecular weight of 202.27 g/mol. Its IUPAC name is (2Z,4E)-2-ethoxy-4-methyl-5-methylsulfanylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-ethoxy-4-methyl-5-methylsulfanylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 143260584 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (2Z,4E)-2-ethoxy-4-methyl-5-methylsulfanylpenta-2,4-dienoic acid |
| SMILES | CCO/C(=C\C(C)=C\SC)C(=O)O |
| InChI | InChI=1S/C9H14O3S/c1-4-12-8(9(10)11)5-7(2)6-13-3/h5-6H,4H2,1-3H3,(H,10,11)/b7-6+,8-5- |
| InChIKey | YAVRUBAMYWLLLF-NGWHPUCNSA-N |
| XLogP | 2.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|