C8H11F3O4 — CID 93477356
ethyl (2R,3S)-2-hydroxy-3-methyl-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 93477356) has the molecular formula C8H11F3O4 and a molecular weight of 228.17 g/mol. Its IUPAC name is ethyl (2R,3S)-2-hydroxy-3-methyl-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | ethyl (2R,3S)-2-hydroxy-3-methyl-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 93477356 |
| Molecular Formula | C8H11F3O4 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethyl (2R,3S)-2-hydroxy-3-methyl-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)[C@](O)([C@H](C)C=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O4/c1-3-15-6(13)7(14,5(2)4-12)8(9,10)11/h4-5,14H,3H2,1-2H3/t5-,7-/m1/s1 |
| InChIKey | GIPLLVWXUVJPGK-IYSWYEEDSA-N |
| XLogP | 0.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|