C20H8F21NO5 — CID 597975
[4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 597975) has the molecular formula C20H8F21NO5 and a molecular weight of 741.24 g/mol. Its IUPAC name is [4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 597975 |
| Molecular Formula | C20H8F21NO5 |
| Molecular Weight | 741.24 g/mol |
| Exact Mass | 741.01 |
| IUPAC Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(NCC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H8F21NO5/c21-12(22,15(27,28)18(33,34)35)9(43)42-5-8(47-11(45)14(25,26)17(31,32)20(39,40)41)6-1-3-7(4-2-6)46-10(44)13(23,24)16(29,30)19(36,37)38/h1-4,8H,5H2,(H,42,43) |
| InChIKey | HIUHYYIAZBIILC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.24 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|