C19H12F15NO6 — CID 634787
[4-[1-ethoxy-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 634787) has the molecular formula C19H12F15NO6 and a molecular weight of 635.28 g/mol. Its IUPAC name is [4-[1-ethoxy-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[1-ethoxy-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 634787 |
| Molecular Formula | C19H12F15NO6 |
| Molecular Weight | 635.28 g/mol |
| Exact Mass | 635.04 |
| IUPAC Name | [4-[1-ethoxy-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCOC(CNC(=O)C(F)(F)C(F)(F)F)c1ccc(OC(=O)C(F)(F)C(F)(F)F)c(OC(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F15NO6/c1-2-39-10(6-35-11(36)14(20,21)17(26,27)28)7-3-4-8(40-12(37)15(22,23)18(29,30)31)9(5-7)41-13(38)16(24,25)19(32,33)34/h3-5,10H,2,6H2,1H3,(H,35,36) |
| InChIKey | KFZLGUFXHIHPCJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|