C20H9F18NO7 — CID 528874
[4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-(2,2,2-trifluoroethoxy)propyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 528874) has the molecular formula C20H9F18NO7 and a molecular weight of 717.26 g/mol. Its IUPAC name is [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-(2,2,2-trifluoroethoxy)propyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-(2,2,2-trifluoroethoxy)propyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 528874 |
| Molecular Formula | C20H9F18NO7 |
| Molecular Weight | 717.26 g/mol |
| Exact Mass | 717.01 |
| IUPAC Name | [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-(2,2,2-trifluoroethoxy)propyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCC(F)(F)F)C(Cc1ccc(OC(=O)C(F)(F)C(F)(F)F)c(OC(=O)C(F)(F)C(F)(F)F)c1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H9F18NO7/c21-14(22,23)5-44-10(40)7(39-11(41)15(24,25)18(30,31)32)3-6-1-2-8(45-12(42)16(26,27)19(33,34)35)9(4-6)46-13(43)17(28,29)20(36,37)38/h1-2,4,7H,3,5H2,(H,39,41) |
| InChIKey | GFFAEDKYDRYONH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|